C28H31FO2S — CID 15327846
[3-[2-adamantylidene-(4-fluorophenyl)sulfanylmethyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 15327846) has the molecular formula C28H31FO2S and a molecular weight of 450.62 g/mol. Its IUPAC name is [3-[2-adamantylidene-(4-fluorophenyl)sulfanylmethyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-[2-adamantylidene-(4-fluorophenyl)sulfanylmethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15327846 |
| Molecular Formula | C28H31FO2S |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [3-[2-adamantylidene-(4-fluorophenyl)sulfanylmethyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cccc(C(Sc2ccc(F)cc2)=C2C3CC4CC(C3)CC2C4)c1 |
| InChI | InChI=1S/C28H31FO2S/c1-28(2,3)27(30)31-23-6-4-5-19(16-23)26(32-24-9-7-22(29)8-10-24)25-20-12-17-11-18(14-20)15-21(25)13-17/h4-10,16-18,20-21H,11-15H2,1-3H3/b26-25- |
| InChIKey | FHUKLPCVVTWRKU-QPLCGJKRSA-N |
| XLogP | 7.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|