C28H31FO4S — CID 15327848
[3-[3'-(4-fluorophenyl)sulfanylspiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 15327848) has the molecular formula C28H31FO4S and a molecular weight of 482.62 g/mol. Its IUPAC name is [3-[3'-(4-fluorophenyl)sulfanylspiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-[3'-(4-fluorophenyl)sulfanylspiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15327848 |
| Molecular Formula | C28H31FO4S |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [3-[3'-(4-fluorophenyl)sulfanylspiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cccc(C2(Sc3ccc(F)cc3)OOC23C2CC4CC(C2)CC3C4)c1 |
| InChI | InChI=1S/C28H31FO4S/c1-26(2,3)25(30)31-23-6-4-5-19(16-23)28(34-24-9-7-22(29)8-10-24)27(32-33-28)20-12-17-11-18(14-20)15-21(27)13-17/h4-10,16-18,20-21H,11-15H2,1-3H3 |
| InChIKey | YLUSFCVMEZMMBK-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|