About indol-1-ium-2-one
indol-1-ium-2-one (PubChem CID 153278873) has the molecular formula C8H6NO+
and a molecular weight of 132.14 g/mol. Its IUPAC name is indol-1-ium-2-one.
Molecular Properties
| Compound Name | indol-1-ium-2-one |
| PubChem CID | 153278873 |
| Molecular Formula | C8H6NO+ |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | indol-1-ium-2-one |
| SMILES | O=C1C=c2ccccc2=[NH+]1 |
| InChI | InChI=1S/C8H5NO/c10-8-5-6-3-1-2-4-7(6)9-8/h1-5H/p+1 |
| InChIKey | QNLOWBMKUIXCOW-UHFFFAOYSA-O |
| XLogP | -2.29 |
| TPSA | 31.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indol-1-ium-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-1-ium-2-one?
The IUPAC name of indol-1-ium-2-one (CID 153278873) is indol-1-ium-2-one.
What is the SMILES notation for indol-1-ium-2-one?
The canonical SMILES for indol-1-ium-2-one is O=C1C=c2ccccc2=[NH+]1.
What is the InChIKey of indol-1-ium-2-one?
The InChIKey is QNLOWBMKUIXCOW-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H5NO/c10-8-5-6-3-1-2-4-7(6)9-8/h1-5H/p+1.
What are the key properties of indol-1-ium-2-one?
indol-1-ium-2-one has a molecular weight of 132.14 g/mol, XLogP of -2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indol-1-ium-2-one is sourced from PubChem (CID 153278873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).