C22H38Si2 — CID 15327904
[dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 15327904) has the molecular formula C22H38Si2 and a molecular weight of 358.72 g/mol. Its IUPAC name is [dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | [dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 15327904 |
| Molecular Formula | C22H38Si2 |
| Molecular Weight | 358.72 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](C)(C)[Si](C)(C)C2C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C22H38Si2/c1-13-14(2)18(6)21(17(13)5)23(9,10)24(11,12)22-19(7)15(3)16(4)20(22)8/h21-22H,1-12H3 |
| InChIKey | DUJZGBONCHNERU-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.72 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|