C15H18N2O2 — CID 153279274
(8aS)-2-acetyl-7-isocyano-5,5,8a-trimethyl-1,3-dihydroisoquinolin-6-one (PubChem CID 153279274) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (8aS)-2-acetyl-7-isocyano-5,5,8a-trimethyl-1,3-dihydroisoquinolin-6-one.
| Compound Name | (8aS)-2-acetyl-7-isocyano-5,5,8a-trimethyl-1,3-dihydroisoquinolin-6-one |
|---|---|
| PubChem CID | 153279274 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (8aS)-2-acetyl-7-isocyano-5,5,8a-trimethyl-1,3-dihydroisoquinolin-6-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)CN(C(C)=O)CC=C2C(C)(C)C1=O |
| InChI | InChI=1S/C15H18N2O2/c1-10(18)17-7-6-12-14(2,3)13(19)11(16-5)8-15(12,4)9-17/h6,8H,7,9H2,1-4H3/t15-/m1/s1 |
| InChIKey | IMWLWTIYQQIDOE-OAHLLOKOSA-N |
| XLogP | 2.19 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|