C16H26NO3P — CID 153279289
5',5'-dimethyl-8'a-phosphanyl-2'-propan-2-ylspiro[1,3-dioxolane-2,6'-7,8-dihydro-3H-isoquinoline]-1'-one (PubChem CID 153279289) has the molecular formula C16H26NO3P and a molecular weight of 311.36 g/mol. Its IUPAC name is 5',5'-dimethyl-8'a-phosphanyl-2'-propan-2-ylspiro[1,3-dioxolane-2,6'-7,8-dihydro-3H-isoquinoline]-1'-one.
| Compound Name | 5',5'-dimethyl-8'a-phosphanyl-2'-propan-2-ylspiro[1,3-dioxolane-2,6'-7,8-dihydro-3H-isoquinoline]-1'-one |
|---|---|
| PubChem CID | 153279289 |
| Molecular Formula | C16H26NO3P |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 5',5'-dimethyl-8'a-phosphanyl-2'-propan-2-ylspiro[1,3-dioxolane-2,6'-7,8-dihydro-3H-isoquinoline]-1'-one |
| SMILES | CC(C)N1CC=C2C(P)(CCC3(OCCO3)C2(C)C)C1=O |
| InChI | InChI=1S/C16H26NO3P/c1-11(2)17-8-5-12-14(3,4)16(19-9-10-20-16)7-6-15(12,21)13(17)18/h5,11H,6-10,21H2,1-4H3 |
| InChIKey | WRBRVPDELGWQFL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|