About (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane
(2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane (PubChem CID 15327956) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane |
| PubChem CID | 15327956 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane |
| SMILES | C=C1/C(=C/C2C=CC=C2)N2CCC1CC2 |
| InChI | InChI=1S/C14H17N/c1-11-13-6-8-15(9-7-13)14(11)10-12-4-2-3-5-12/h2-5,10,12-13H,1,6-9H2/b14-10- |
| InChIKey | HJGAOOZXWDOCLI-UVTDQMKNSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane?
The IUPAC name of (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane (CID 15327956) is (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane.
What is the SMILES notation for (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane?
The canonical SMILES for (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane is C=C1/C(=C/C2C=CC=C2)N2CCC1CC2.
What is the InChIKey of (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane?
The InChIKey is HJGAOOZXWDOCLI-UVTDQMKNSA-N. The full InChI is InChI=1S/C14H17N/c1-11-13-6-8-15(9-7-13)14(11)10-12-4-2-3-5-12/h2-5,10,12-13H,1,6-9H2/b14-10-.
What are the key properties of (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane?
(2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane has a molecular weight of 199.30 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(cyclopenta-2,4-dien-1-ylmethylidene)-3-methylidene-1-azabicyclo[2.2.2]octane is sourced from PubChem (CID 15327956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).