About ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate
ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 153279641) has the molecular formula C26H19F2NO4
and a molecular weight of 447.44 g/mol. Its IUPAC name is ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| PubChem CID | 153279641 |
| Molecular Formula | C26H19F2NO4 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | [C-]#[N+]c1cc(F)cc(-c2cc(COc3ccccc3CC(=O)OCC)cc3ccoc23)c1F |
| InChI | InChI=1S/C26H19F2NO4/c1-3-31-24(30)12-17-6-4-5-7-23(17)33-15-16-10-18-8-9-32-26(18)21(11-16)20-13-19(27)14-22(29-2)25(20)28/h4-11,13-14H,3,12,15H2,1H3 |
| InChIKey | IEQJZWYPTNPYOH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 53.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate?
The IUPAC name of ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate (CID 153279641) is ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate.
What is the SMILES notation for ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate?
The canonical SMILES for ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate is [C-]#[N+]c1cc(F)cc(-c2cc(COc3ccccc3CC(=O)OCC)cc3ccoc23)c1F.
What is the InChIKey of ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate?
The InChIKey is IEQJZWYPTNPYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19F2NO4/c1-3-31-24(30)12-17-6-4-5-7-23(17)33-15-16-10-18-8-9-32-26(18)21(11-16)20-13-19(27)14-22(29-2)25(20)28/h4-11,13-14H,3,12,15H2,1H3.
What are the key properties of ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate?
ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate has a molecular weight of 447.44 g/mol, XLogP of 6.61, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[[7-(2,5-difluoro-3-isocyanophenyl)-1-benzofuran-5-yl]methoxy]phenyl]acetate is sourced from PubChem (CID 153279641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).