C27H20N5OPtS- — CID 153280205
2-[4-(2,6-dimethyl-4-pyridinyl)-6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum (PubChem CID 153280205) has the molecular formula C27H20N5OPtS- and a molecular weight of 657.64 g/mol. Its IUPAC name is 2-[4-(2,6-dimethyl-4-pyridinyl)-6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum.
| Compound Name | 2-[4-(2,6-dimethyl-4-pyridinyl)-6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280205 |
| Molecular Formula | C27H20N5OPtS- |
| Molecular Weight | 657.64 g/mol |
| Exact Mass | 657.10 |
| IUPAC Name | 2-[4-(2,6-dimethyl-4-pyridinyl)-6-(3-pyridin-2-ylsulfanylbenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum |
| SMILES | Cc1cc(-c2nc(-c3[c-]c(Sc4ccccn4)ccc3)nc(-c3ccccc3O)n2)cc(C)n1.[Pt] |
| InChI | InChI=1S/C27H20N5OS.Pt/c1-17-14-20(15-18(2)29-17)26-30-25(31-27(32-26)22-10-3-4-11-23(22)33)19-8-7-9-21(16-19)34-24-12-5-6-13-28-24;/h3-15,33H,1-2H3;/q-1; |
| InChIKey | RXBINFRBHOEDMK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 84.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|