C32H23N4OPtS- — CID 153280215
2-[4-(3-isoquinolin-1-ylsulfanylbenzene-2-id-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-4,6-dimethylphenol;platinum (PubChem CID 153280215) has the molecular formula C32H23N4OPtS- and a molecular weight of 706.71 g/mol. Its IUPAC name is 2-[4-(3-isoquinolin-1-ylsulfanylbenzene-2-id-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-4,6-dimethylphenol;platinum.
| Compound Name | 2-[4-(3-isoquinolin-1-ylsulfanylbenzene-2-id-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-4,6-dimethylphenol;platinum |
|---|---|
| PubChem CID | 153280215 |
| Molecular Formula | C32H23N4OPtS- |
| Molecular Weight | 706.71 g/mol |
| Exact Mass | 706.12 |
| IUPAC Name | 2-[4-(3-isoquinolin-1-ylsulfanylbenzene-2-id-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-4,6-dimethylphenol;platinum |
| SMILES | Cc1cc(C)c(O)c(-c2nc(-c3[c-]c(Sc4nccc5ccccc45)ccc3)nc(-c3ccccc3)n2)c1.[Pt] |
| InChI | InChI=1S/C32H23N4OS.Pt/c1-20-17-21(2)28(37)27(18-20)31-35-29(23-10-4-3-5-11-23)34-30(36-31)24-12-8-13-25(19-24)38-32-26-14-7-6-9-22(26)15-16-33-32;/h3-18,37H,1-2H3;/q-1; |
| InChIKey | NZZAFYXSJVIWTD-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.71 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|