About 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum
2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum (PubChem CID 153280231) has the molecular formula C26H17N4O2Pt-
and a molecular weight of 612.53 g/mol. Its IUPAC name is 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum.
Molecular Properties
| Compound Name | 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum |
| PubChem CID | 153280231 |
| Molecular Formula | C26H17N4O2Pt- |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum |
| SMILES | Oc1ccccc1-c1nc(-c2[c-]c(Oc3ccccn3)ccc2)nc(-c2ccccc2)n1.[Pt] |
| InChI | InChI=1S/C26H17N4O2.Pt/c31-22-14-5-4-13-21(22)26-29-24(18-9-2-1-3-10-18)28-25(30-26)19-11-8-12-20(17-19)32-23-15-6-7-16-27-23;/h1-16,31H;/q-1; |
| InChIKey | MLABFPLCOGLJCX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum?
The IUPAC name of 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum (CID 153280231) is 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum.
What is the SMILES notation for 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum?
The canonical SMILES for 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum is Oc1ccccc1-c1nc(-c2[c-]c(Oc3ccccn3)ccc2)nc(-c2ccccc2)n1.[Pt].
What is the InChIKey of 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum?
The InChIKey is MLABFPLCOGLJCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17N4O2.Pt/c31-22-14-5-4-13-21(22)26-29-24(18-9-2-1-3-10-18)28-25(30-26)19-11-8-12-20(17-19)32-23-15-6-7-16-27-23;/h1-16,31H;/q-1;.
What are the key properties of 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum?
2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum has a molecular weight of 612.53 g/mol, XLogP of 5.56, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-phenyl-6-(3-pyridin-2-yloxybenzene-2-id-1-yl)-1,3,5-triazin-2-yl]phenol;platinum is sourced from PubChem (CID 153280231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).