C33H31N4O2Pt- — CID 153280247
2-[4-(3-tert-butyl-5-pyridin-2-yloxybenzene-6-id-1-yl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]phenol;platinum (PubChem CID 153280247) has the molecular formula C33H31N4O2Pt- and a molecular weight of 710.72 g/mol. Its IUPAC name is 2-[4-(3-tert-butyl-5-pyridin-2-yloxybenzene-6-id-1-yl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]phenol;platinum.
| Compound Name | 2-[4-(3-tert-butyl-5-pyridin-2-yloxybenzene-6-id-1-yl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280247 |
| Molecular Formula | C33H31N4O2Pt- |
| Molecular Weight | 710.72 g/mol |
| Exact Mass | 710.21 |
| IUPAC Name | 2-[4-(3-tert-butyl-5-pyridin-2-yloxybenzene-6-id-1-yl)-6-(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]phenol;platinum |
| SMILES | Cc1cc(C)c(-c2nc(-c3[c-]c(Oc4ccccn4)cc(C(C)(C)C)c3)nc(-c3ccccc3O)n2)c(C)c1.[Pt] |
| InChI | InChI=1S/C33H31N4O2.Pt/c1-20-15-21(2)29(22(3)16-20)32-36-30(35-31(37-32)26-11-7-8-12-27(26)38)23-17-24(33(4,5)6)19-25(18-23)39-28-13-9-10-14-34-28;/h7-17,19,38H,1-6H3;/q-1; |
| InChIKey | MKLDMRWTMPFBJP-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.72 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|