C20H28O4 — CID 153280902
(6R,7R)-7-[(3S)-3-(1,3-dioxolan-2-yl)-3-methylpent-4-enoyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one (PubChem CID 153280902) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (6R,7R)-7-[(3S)-3-(1,3-dioxolan-2-yl)-3-methylpent-4-enoyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one.
| Compound Name | (6R,7R)-7-[(3S)-3-(1,3-dioxolan-2-yl)-3-methylpent-4-enoyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 153280902 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (6R,7R)-7-[(3S)-3-(1,3-dioxolan-2-yl)-3-methylpent-4-enoyl]-6,7-dimethyl-3,4,5,6-tetrahydro-2H-inden-1-one |
| SMILES | C=C[C@](C)(CC(=O)[C@@]1(C)C2=C(CCC2=O)CC[C@H]1C)C1OCCO1 |
| InChI | InChI=1S/C20H28O4/c1-5-19(3,18-23-10-11-24-18)12-16(22)20(4)13(2)6-7-14-8-9-15(21)17(14)20/h5,13,18H,1,6-12H2,2-4H3/t13-,19-,20+/m1/s1 |
| InChIKey | PZCIRTAIMRSCKY-GBLZOACLSA-N |
| XLogP | 3.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|