C34H21N6Re- — CID 153281050
2-phenyl-1,10-phenanthroline;2-pyrazin-2-yl-1,10-phenanthroline;rhenium (PubChem CID 153281050) has the molecular formula C34H21N6Re- and a molecular weight of 699.79 g/mol. Its IUPAC name is 2-phenyl-1,10-phenanthroline;2-pyrazin-2-yl-1,10-phenanthroline;rhenium.
| Compound Name | 2-phenyl-1,10-phenanthroline;2-pyrazin-2-yl-1,10-phenanthroline;rhenium |
|---|---|
| PubChem CID | 153281050 |
| Molecular Formula | C34H21N6Re- |
| Molecular Weight | 699.79 g/mol |
| Exact Mass | 700.14 |
| IUPAC Name | 2-phenyl-1,10-phenanthroline;2-pyrazin-2-yl-1,10-phenanthroline;rhenium |
| SMILES | [Re].[c-]1ccccc1-c1ccc2ccc3cccnc3c2n1.c1cnc2c(c1)ccc1ccc(-c3cnccn3)nc12 |
| InChI | InChI=1S/C18H11N2.C16H10N4.Re/c1-2-5-13(6-3-1)16-11-10-15-9-8-14-7-4-12-19-17(14)18(15)20-16;1-2-11-3-4-12-5-6-13(14-10-17-8-9-18-14)20-16(12)15(11)19-7-1;/h1-5,7-12H;1-10H;/q-1;; |
| InChIKey | MNUQTFWNLQCMJD-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.79 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|