C12H22N4O — CID 153281312
5,7-dimethyl-1,4,8,11-tetrazacyclotetradeca-4,7-dien-6-one (PubChem CID 153281312) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 5,7-dimethyl-1,4,8,11-tetrazacyclotetradeca-4,7-dien-6-one.
| Compound Name | 5,7-dimethyl-1,4,8,11-tetrazacyclotetradeca-4,7-dien-6-one |
|---|---|
| PubChem CID | 153281312 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 5,7-dimethyl-1,4,8,11-tetrazacyclotetradeca-4,7-dien-6-one |
| SMILES | C/C1=N/CCNCCCNCC/N=C(\C)C1=O |
| InChI | InChI=1S/C12H22N4O/c1-10-12(17)11(2)16-9-7-14-5-3-4-13-6-8-15-10/h13-14H,3-9H2,1-2H3/b15-10-,16-11+ |
| InChIKey | YTUQQMSCRAJGJJ-MBKDJOQRSA-N |
| XLogP | 0.06 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |