C13H24O4 — CID 153281511
(1S,3S,4S,6S,7S)-6-methyl-7-propan-2-yloxy-1-(propan-2-yloxymethyl)-3-tritio-2,5-dioxabicyclo[2.2.1]heptane (PubChem CID 153281511) has the molecular formula C13H24O4 and a molecular weight of 246.34 g/mol. Its IUPAC name is (1S,3S,4S,6S,7S)-6-methyl-7-propan-2-yloxy-1-(propan-2-yloxymethyl)-3-tritio-2,5-dioxabicyclo[2.2.1]heptane.
| Compound Name | (1S,3S,4S,6S,7S)-6-methyl-7-propan-2-yloxy-1-(propan-2-yloxymethyl)-3-tritio-2,5-dioxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 153281511 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (1S,3S,4S,6S,7S)-6-methyl-7-propan-2-yloxy-1-(propan-2-yloxymethyl)-3-tritio-2,5-dioxabicyclo[2.2.1]heptane |
| SMILES | [3H][C@@H]1O[C@@]2(COC(C)C)[C@H](C)O[C@@H]1[C@@H]2OC(C)C |
| InChI | InChI=1S/C13H24O4/c1-8(2)14-7-13-10(5)17-11(6-15-13)12(13)16-9(3)4/h8-12H,6-7H2,1-5H3/t10-,11-,12-,13-/m0/s1/i6T/t6-,10-,11-,12-,13- |
| InChIKey | ZHDFXZOSBBXLNB-NARFAUJQSA-N |
| XLogP | 1.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |