C45H64O6S2 — CID 153282685
2,6-di(propan-2-yl)-4-[2,4,6-tris(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonic acid (PubChem CID 153282685) has the molecular formula C45H64O6S2 and a molecular weight of 765.14 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-4-[2,4,6-tris(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonic acid.
| Compound Name | 2,6-di(propan-2-yl)-4-[2,4,6-tris(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 153282685 |
| Molecular Formula | C45H64O6S2 |
| Molecular Weight | 765.14 g/mol |
| Exact Mass | 764.41 |
| IUPAC Name | 2,6-di(propan-2-yl)-4-[2,4,6-tris(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]sulfonyloxybenzenesulfonic acid |
| SMILES | CC(C)c1cc(OS(=O)(=O)c2c(C3CC4CCC3C4(C)C)cc(C3CC4CCC3C4(C)C)cc2C2CC3CCC2C3(C)C)cc(C(C)C)c1S(=O)(=O)O |
| InChI | InChI=1S/C45H64O6S2/c1-24(2)31-22-30(23-32(25(3)4)41(31)52(46,47)48)51-53(49,50)42-36(34-20-28-12-15-39(34)44(28,7)8)17-26(33-19-27-11-14-38(33)43(27,5)6)18-37(42)35-21-29-13-16-40(35)45(29,9)10/h17-18,22-25,27-29,33-35,38-40H,11-16,19-21H2,1-10H3,(H,46,47,48) |
| InChIKey | HCRDJDXYOXGQQL-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.14 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|