C14H17N5O6 — CID 153282919
[(2S,4R,5R)-4-acetyloxy-5-(2-amino-8-oxo-7H-purin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 153282919) has the molecular formula C14H17N5O6 and a molecular weight of 351.32 g/mol. Its IUPAC name is [(2S,4R,5R)-4-acetyloxy-5-(2-amino-8-oxo-7H-purin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,4R,5R)-4-acetyloxy-5-(2-amino-8-oxo-7H-purin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 153282919 |
| Molecular Formula | C14H17N5O6 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [(2S,4R,5R)-4-acetyloxy-5-(2-amino-8-oxo-7H-purin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@@H](OC(C)=O)[C@H](n2c(=O)[nH]c3cnc(N)nc32)O1 |
| InChI | InChI=1S/C14H17N5O6/c1-6(20)23-5-8-3-10(24-7(2)21)12(25-8)19-11-9(17-14(19)22)4-16-13(15)18-11/h4,8,10,12H,3,5H2,1-2H3,(H,17,22)(H2,15,16,18)/t8-,10+,12+/m0/s1 |
| InChIKey | GDXNHFUURIMAHR-MKPLZMMCSA-N |
| XLogP | -0.52 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |