About N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide
N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide (PubChem CID 153282963) has the molecular formula C13H17N5O4
and a molecular weight of 307.31 g/mol. Its IUPAC name is N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide |
| PubChem CID | 153282963 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide |
| SMILES | CCCCn1c(=O)[nH]c2nc(N(C(C)=O)C(C)=O)[nH]c(=O)c21 |
| InChI | InChI=1S/C13H17N5O4/c1-4-5-6-17-9-10(15-13(17)22)14-12(16-11(9)21)18(7(2)19)8(3)20/h4-6H2,1-3H3,(H2,14,15,16,21,22) |
| InChIKey | HMXRSXMEUWDOKA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 120.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide?
The IUPAC name of N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide (CID 153282963) is N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide.
What is the SMILES notation for N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide?
The canonical SMILES for N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide is CCCCn1c(=O)[nH]c2nc(N(C(C)=O)C(C)=O)[nH]c(=O)c21.
What is the InChIKey of N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide?
The InChIKey is HMXRSXMEUWDOKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O4/c1-4-5-6-17-9-10(15-13(17)22)14-12(16-11(9)21)18(7(2)19)8(3)20/h4-6H2,1-3H3,(H2,14,15,16,21,22).
What are the key properties of N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide?
N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide has a molecular weight of 307.31 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-(7-butyl-6,8-dioxo-1,9-dihydropurin-2-yl)acetamide is sourced from PubChem (CID 153282963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).