C83H54N2 — CID 153283269
7-[3-[2,4-bis(2,3-diethynylphenyl)phenyl]phenyl]-9,9-dimethyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 153283269) has the molecular formula C83H54N2 and a molecular weight of 1079.36 g/mol. Its IUPAC name is 7-[3-[2,4-bis(2,3-diethynylphenyl)phenyl]phenyl]-9,9-dimethyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 7-[3-[2,4-bis(2,3-diethynylphenyl)phenyl]phenyl]-9,9-dimethyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 153283269 |
| Molecular Formula | C83H54N2 |
| Molecular Weight | 1079.36 g/mol |
| Exact Mass | 1078.43 |
| IUPAC Name | 7-[3-[2,4-bis(2,3-diethynylphenyl)phenyl]phenyl]-9,9-dimethyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | C#Cc1cccc(-c2ccc(-c3cccc(-c4ccc5c(c4)C(C)(C)c4cc(N(c6ccc(-c7ccccc7)cc6)c6ccc(-c7ccc8c(c7)c7ccccc7n8-c7ccccc7)cc6)ccc4-5)c3)c(-c3cccc(C#C)c3C#C)c2)c1C#C |
| InChI | InChI=1S/C83H54N2/c1-7-55-24-20-31-71(69(55)9-3)64-39-46-72(77(52-64)73-32-21-25-56(8-2)70(73)10-4)63-27-19-26-60(50-63)62-38-47-74-75-48-45-68(54-80(75)83(5,6)79(74)53-62)84(66-41-34-58(35-42-66)57-22-13-11-14-23-57)67-43-36-59(37-44-67)61-40-49-82-78(51-61)76-30-17-18-33-81(76)85(82)65-28-15-12-16-29-65/h1-4,11-54H,5-6H3 |
| InChIKey | MBDCGVZHPLQYHC-UHFFFAOYSA-N |
| XLogP | 20.49 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.36 |
| LogP ≤ 5 | 20.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|