C17H25Cl2N3O — CID 153284041
(2R,3S)-2-[(E)-3-(3,5-dimethylindazol-1-yl)prop-1-enyl]piperidin-3-ol;dihydrochloride (PubChem CID 153284041) has the molecular formula C17H25Cl2N3O and a molecular weight of 358.31 g/mol. Its IUPAC name is (2R,3S)-2-[(E)-3-(3,5-dimethylindazol-1-yl)prop-1-enyl]piperidin-3-ol;dihydrochloride.
| Compound Name | (2R,3S)-2-[(E)-3-(3,5-dimethylindazol-1-yl)prop-1-enyl]piperidin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 153284041 |
| Molecular Formula | C17H25Cl2N3O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2R,3S)-2-[(E)-3-(3,5-dimethylindazol-1-yl)prop-1-enyl]piperidin-3-ol;dihydrochloride |
| SMILES | Cc1ccc2c(c1)c(C)nn2C/C=C/[C@H]1NCCC[C@@H]1O.Cl.Cl |
| InChI | InChI=1S/C17H23N3O.2ClH/c1-12-7-8-16-14(11-12)13(2)19-20(16)10-4-5-15-17(21)6-3-9-18-15;;/h4-5,7-8,11,15,17-18,21H,3,6,9-10H2,1-2H3;2*1H/b5-4+;;/t15-,17+;;/m1../s1 |
| InChIKey | AYNJMVVNDYXYSK-ICNYOAMWSA-N |
| XLogP | 3.17 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|