C23H28N4O — CID 153284474
N-[2-[(4aS,12bS)-1-cyano-4a-ethyl-6-methyl-2,3,4,12b-tetrahydroindolo[1,2-h][1,7]naphthyridin-12-yl]ethyl]acetamide (PubChem CID 153284474) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[2-[(4aS,12bS)-1-cyano-4a-ethyl-6-methyl-2,3,4,12b-tetrahydroindolo[1,2-h][1,7]naphthyridin-12-yl]ethyl]acetamide.
| Compound Name | N-[2-[(4aS,12bS)-1-cyano-4a-ethyl-6-methyl-2,3,4,12b-tetrahydroindolo[1,2-h][1,7]naphthyridin-12-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 153284474 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[2-[(4aS,12bS)-1-cyano-4a-ethyl-6-methyl-2,3,4,12b-tetrahydroindolo[1,2-h][1,7]naphthyridin-12-yl]ethyl]acetamide |
| SMILES | CC[C@]12C=C(C)n3c(c(CCNC(C)=O)c4ccccc43)[C@H]1N(C#N)CCC2 |
| InChI | InChI=1S/C23H28N4O/c1-4-23-11-7-13-26(15-24)22(23)21-19(10-12-25-17(3)28)18-8-5-6-9-20(18)27(21)16(2)14-23/h5-6,8-9,14,22H,4,7,10-13H2,1-3H3,(H,25,28)/t22-,23+/m1/s1 |
| InChIKey | GGXQNTJMCYIPKU-PKTZIBPZSA-N |
| XLogP | 4.21 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|