C25H32N2O6 — CID 153284532
methyl (9S,11S,19R)-11-ethyl-9,19-dihydroxy-15-[(E)-3-methoxy-3-oxoprop-1-enyl]-8,15-diazatetracyclo[9.6.2.02,7.08,18]nonadeca-1(18),2,4,6-tetraene-9-carboxylate (PubChem CID 153284532) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is methyl (9S,11S,19R)-11-ethyl-9,19-dihydroxy-15-[(E)-3-methoxy-3-oxoprop-1-enyl]-8,15-diazatetracyclo[9.6.2.02,7.08,18]nonadeca-1(18),2,4,6-tetraene-9-carboxylate.
| Compound Name | methyl (9S,11S,19R)-11-ethyl-9,19-dihydroxy-15-[(E)-3-methoxy-3-oxoprop-1-enyl]-8,15-diazatetracyclo[9.6.2.02,7.08,18]nonadeca-1(18),2,4,6-tetraene-9-carboxylate |
|---|---|
| PubChem CID | 153284532 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | methyl (9S,11S,19R)-11-ethyl-9,19-dihydroxy-15-[(E)-3-methoxy-3-oxoprop-1-enyl]-8,15-diazatetracyclo[9.6.2.02,7.08,18]nonadeca-1(18),2,4,6-tetraene-9-carboxylate |
| SMILES | CC[C@]12CCCN(/C=C/C(=O)OC)CCc3c(n(c4ccccc34)[C@@](O)(C(=O)OC)C1)[C@@H]2O |
| InChI | InChI=1S/C25H32N2O6/c1-4-24-12-7-13-26(15-11-20(28)32-2)14-10-18-17-8-5-6-9-19(17)27(21(18)22(24)29)25(31,16-24)23(30)33-3/h5-6,8-9,11,15,22,29,31H,4,7,10,12-14,16H2,1-3H3/b15-11+/t22-,24-,25-/m0/s1 |
| InChIKey | CCZDUKAHDMODNO-FSWLQUBRSA-N |
| XLogP | 2.62 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|