C24H44F2O4Si — CID 153284672
ethyl 5-[(4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluoro-3-hydroxyhexanoate (PubChem CID 153284672) has the molecular formula C24H44F2O4Si and a molecular weight of 462.69 g/mol. Its IUPAC name is ethyl 5-[(4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluoro-3-hydroxyhexanoate.
| Compound Name | ethyl 5-[(4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluoro-3-hydroxyhexanoate |
|---|---|
| PubChem CID | 153284672 |
| Molecular Formula | C24H44F2O4Si |
| Molecular Weight | 462.69 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | ethyl 5-[(4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluoro-3-hydroxyhexanoate |
| SMILES | CCOC(=O)C(F)(F)C(O)CC(C)C1CCC2[C@@H](O[Si](CC)(CC)CC)CCC[C@]12C |
| InChI | InChI=1S/C24H44F2O4Si/c1-7-29-22(28)24(25,26)21(27)16-17(5)18-13-14-19-20(12-11-15-23(18,19)6)30-31(8-2,9-3)10-4/h17-21,27H,7-16H2,1-6H3/t17?,18?,19?,20-,21?,23+/m0/s1 |
| InChIKey | NAEKPURTPJFZEO-VYWXOHOGSA-N |
| XLogP | 6.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|