C22H40MnNO3P2+2 — CID 153284875
[6-[di(propan-2-yl)phosphaniumylmethyl]-2-pyridinyl]methyl-di(propan-2-yl)phosphanium;manganese(3+);methanone (PubChem CID 153284875) has the molecular formula C22H40MnNO3P2+2 and a molecular weight of 483.45 g/mol. Its IUPAC name is [6-[di(propan-2-yl)phosphaniumylmethyl]-2-pyridinyl]methyl-di(propan-2-yl)phosphanium;manganese(3+);methanone.
| Compound Name | [6-[di(propan-2-yl)phosphaniumylmethyl]-2-pyridinyl]methyl-di(propan-2-yl)phosphanium;manganese(3+);methanone |
|---|---|
| PubChem CID | 153284875 |
| Molecular Formula | C22H40MnNO3P2+2 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [6-[di(propan-2-yl)phosphaniumylmethyl]-2-pyridinyl]methyl-di(propan-2-yl)phosphanium;manganese(3+);methanone |
| SMILES | CC(C)[PH+](Cc1cccc(C[PH+](C(C)C)C(C)C)n1)C(C)C.[CH-]=O.[CH-]=O.[CH-]=O.[Mn+3] |
| InChI | InChI=1S/C19H35NP2.3CHO.Mn/c1-14(2)21(15(3)4)12-18-10-9-11-19(20-18)13-22(16(5)6)17(7)8;3*1-2;/h9-11,14-17H,12-13H2,1-8H3;3*1H;/q;3*-1;+3/p+2 |
| InChIKey | XJSUJMDXMIMALE-UHFFFAOYSA-P |
| XLogP | 5.32 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|