C42H25N3PtS — CID 153285159
2-[5-(4-phenylphenyl)-9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) (PubChem CID 153285159) has the molecular formula C42H25N3PtS and a molecular weight of 798.83 g/mol. Its IUPAC name is 2-[5-(4-phenylphenyl)-9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+).
| Compound Name | 2-[5-(4-phenylphenyl)-9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) |
|---|---|
| PubChem CID | 153285159 |
| Molecular Formula | C42H25N3PtS |
| Molecular Weight | 798.83 g/mol |
| Exact Mass | 798.14 |
| IUPAC Name | 2-[5-(4-phenylphenyl)-9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(-c2ccccn2)cccc1-n1c2[c-]c(-c3nc4ccccc4s3)ccc2c2c(-c3ccc(-c4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C42H25N3S.Pt/c1-2-10-28(11-3-1)29-19-21-30(22-20-29)34-14-9-17-38-41(34)35-24-23-32(42-44-37-16-4-5-18-40(37)46-42)27-39(35)45(38)33-13-8-12-31(26-33)36-15-6-7-25-43-36;/h1-25H;/q-2;+2 |
| InChIKey | KKBBCKWOVMPGLJ-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.83 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|