C38H21N3O2PtS — CID 153285320
2-[6-(furan-3-yl)-9-[2-(furan-3-yl)-5-pyridin-2-ylbenzene-6-id-1-yl]-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) (PubChem CID 153285320) has the molecular formula C38H21N3O2PtS and a molecular weight of 778.75 g/mol. Its IUPAC name is 2-[6-(furan-3-yl)-9-[2-(furan-3-yl)-5-pyridin-2-ylbenzene-6-id-1-yl]-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+).
| Compound Name | 2-[6-(furan-3-yl)-9-[2-(furan-3-yl)-5-pyridin-2-ylbenzene-6-id-1-yl]-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) |
|---|---|
| PubChem CID | 153285320 |
| Molecular Formula | C38H21N3O2PtS |
| Molecular Weight | 778.75 g/mol |
| Exact Mass | 778.10 |
| IUPAC Name | 2-[6-(furan-3-yl)-9-[2-(furan-3-yl)-5-pyridin-2-ylbenzene-6-id-1-yl]-1H-carbazol-1-id-2-yl]-1,3-benzothiazole;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(-c2ccccn2)ccc(-c2ccoc2)c1-n1c2[c-]c(-c3nc4ccccc4s3)ccc2c2cc(-c3ccoc3)ccc21 |
| InChI | InChI=1S/C38H21N3O2S.Pt/c1-2-7-37-33(6-1)40-38(44-37)26-9-12-30-31-19-24(27-14-17-42-22-27)10-13-34(31)41(36(30)21-26)35-20-25(32-5-3-4-16-39-32)8-11-29(35)28-15-18-43-23-28;/h1-19,22-23H;/q-2;+2 |
| InChIKey | ZMKAJCUOZCBFCD-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.75 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|