C21H14F6N5O2+ — CID 153285815
N-[2-[2,4-bis(trifluoromethyl)phenyl]-5-methyl-1H-pyrazol-2-ium-4-yl]-5-pyridin-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 153285815) has the molecular formula C21H14F6N5O2+ and a molecular weight of 482.36 g/mol. Its IUPAC name is N-[2-[2,4-bis(trifluoromethyl)phenyl]-5-methyl-1H-pyrazol-2-ium-4-yl]-5-pyridin-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[2,4-bis(trifluoromethyl)phenyl]-5-methyl-1H-pyrazol-2-ium-4-yl]-5-pyridin-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 153285815 |
| Molecular Formula | C21H14F6N5O2+ |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-[2-[2,4-bis(trifluoromethyl)phenyl]-5-methyl-1H-pyrazol-2-ium-4-yl]-5-pyridin-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1[nH][n+](-c2ccc(C(F)(F)F)cc2C(F)(F)F)cc1NC(=O)c1cc(-c2ccccn2)on1 |
| InChI | InChI=1S/C21H13F6N5O2/c1-11-16(29-19(33)15-9-18(34-31-15)14-4-2-3-7-28-14)10-32(30-11)17-6-5-12(20(22,23)24)8-13(17)21(25,26)27/h2-10H,1H3,(H,29,33)/p+1 |
| InChIKey | ODLKJSFFPMCKGL-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|