About cobalt(2+);bis(1H-inden-1-ide)
cobalt(2+);bis(1H-inden-1-ide) (PubChem CID 15328664) has the molecular formula C18H14Co
and a molecular weight of 289.24 g/mol. Its IUPAC name is cobalt(2+);bis(1H-inden-1-ide).
Molecular Properties
| Compound Name | cobalt(2+);bis(1H-inden-1-ide) |
| PubChem CID | 15328664 |
| Molecular Formula | C18H14Co |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | cobalt(2+);bis(1H-inden-1-ide) |
| SMILES | [Co+2].c1ccc2[cH-]ccc2c1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/2C9H7.Co/c2*1-2-5-9-7-3-6-8(9)4-1;/h2*1-7H;/q2*-1;+2 |
| InChIKey | ANMQEISIHVCEDZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis(1H-inden-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(1H-inden-1-ide)?
The IUPAC name of cobalt(2+);bis(1H-inden-1-ide) (CID 15328664) is cobalt(2+);bis(1H-inden-1-ide).
What is the SMILES notation for cobalt(2+);bis(1H-inden-1-ide)?
The canonical SMILES for cobalt(2+);bis(1H-inden-1-ide) is [Co+2].c1ccc2[cH-]ccc2c1.c1ccc2[cH-]ccc2c1.
What is the InChIKey of cobalt(2+);bis(1H-inden-1-ide)?
The InChIKey is ANMQEISIHVCEDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7.Co/c2*1-2-5-9-7-3-6-8(9)4-1;/h2*1-7H;/q2*-1;+2.
What are the key properties of cobalt(2+);bis(1H-inden-1-ide)?
cobalt(2+);bis(1H-inden-1-ide) has a molecular weight of 289.24 g/mol, XLogP of 5.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(1H-inden-1-ide) is sourced from PubChem (CID 15328664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).