C29H34N6O3 — CID 153287033
4-[[[(2R)-1-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]methyl]benzamide (PubChem CID 153287033) has the molecular formula C29H34N6O3 and a molecular weight of 514.63 g/mol. Its IUPAC name is 4-[[[(2R)-1-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]methyl]benzamide.
| Compound Name | 4-[[[(2R)-1-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 153287033 |
| Molecular Formula | C29H34N6O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 4-[[[(2R)-1-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl]amino]methyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@@H](CCc2ccccc2)NCc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C29H34N6O3/c1-19(28(37)34-18-22-7-12-23(13-8-22)26(30)31)35-29(38)25(16-11-20-5-3-2-4-6-20)33-17-21-9-14-24(15-10-21)27(32)36/h2-10,12-15,19,25,33H,11,16-18H2,1H3,(H3,30,31)(H2,32,36)(H,34,37)(H,35,38)/t19-,25+/m0/s1 |
| InChIKey | UMVBXQQFBJAIBU-UQBPGWFLSA-N |
| XLogP | 1.98 |
| TPSA | 163.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|