C16H8F3I3NO8S- — CID 153287350
(2Z)-5-oxo-N-(trifluoromethylsulfonyl)-9-(2,3,6-triiodobenzoyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboximidate (PubChem CID 153287350) has the molecular formula C16H8F3I3NO8S- and a molecular weight of 812.01 g/mol. Its IUPAC name is (2Z)-5-oxo-N-(trifluoromethylsulfonyl)-9-(2,3,6-triiodobenzoyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboximidate.
| Compound Name | (2Z)-5-oxo-N-(trifluoromethylsulfonyl)-9-(2,3,6-triiodobenzoyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboximidate |
|---|---|
| PubChem CID | 153287350 |
| Molecular Formula | C16H8F3I3NO8S- |
| Molecular Weight | 812.01 g/mol |
| Exact Mass | 811.71 |
| IUPAC Name | (2Z)-5-oxo-N-(trifluoromethylsulfonyl)-9-(2,3,6-triiodobenzoyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-2-carboximidate |
| SMILES | O=C(OC1C2OC3C(OC(=O)C31)C2/C([O-])=N/S(=O)(=O)C(F)(F)F)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C16H9F3I3NO8S/c17-16(18,19)32(27,28)23-13(24)6-9-12(7-11(29-9)10(6)30-15(7)26)31-14(25)5-3(20)1-2-4(21)8(5)22/h1-2,6-7,9-12H,(H,23,24)/p-1 |
| InChIKey | GPMPXDCKRYSDQP-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 131.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.01 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|