C19H21NO — CID 153287541
(3aS,9bS)-3,3a-dimethyl-6-phenyl-1,2,4,9b-tetrahydrochromeno[3,4-b]pyrrole (PubChem CID 153287541) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (3aS,9bS)-3,3a-dimethyl-6-phenyl-1,2,4,9b-tetrahydrochromeno[3,4-b]pyrrole.
| Compound Name | (3aS,9bS)-3,3a-dimethyl-6-phenyl-1,2,4,9b-tetrahydrochromeno[3,4-b]pyrrole |
|---|---|
| PubChem CID | 153287541 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (3aS,9bS)-3,3a-dimethyl-6-phenyl-1,2,4,9b-tetrahydrochromeno[3,4-b]pyrrole |
| SMILES | CN1CC[C@H]2c3cccc(-c4ccccc4)c3OC[C@]21C |
| InChI | InChI=1S/C19H21NO/c1-19-13-21-18-15(14-7-4-3-5-8-14)9-6-10-16(18)17(19)11-12-20(19)2/h3-10,17H,11-13H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | HTWKRBASUILJNN-PKOBYXMFSA-N |
| XLogP | 3.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |