C20H24N2 — CID 153287567
(3aS,9bS)-3a,8-dimethyl-5-(4-methylphenyl)-2,3,4,9b-tetrahydro-1H-pyrrolo[2,3-c]quinoline (PubChem CID 153287567) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (3aS,9bS)-3a,8-dimethyl-5-(4-methylphenyl)-2,3,4,9b-tetrahydro-1H-pyrrolo[2,3-c]quinoline.
| Compound Name | (3aS,9bS)-3a,8-dimethyl-5-(4-methylphenyl)-2,3,4,9b-tetrahydro-1H-pyrrolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 153287567 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3aS,9bS)-3a,8-dimethyl-5-(4-methylphenyl)-2,3,4,9b-tetrahydro-1H-pyrrolo[2,3-c]quinoline |
| SMILES | Cc1ccc(N2C[C@@]3(C)NCC[C@H]3c3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C20H24N2/c1-14-4-7-16(8-5-14)22-13-20(3)18(10-11-21-20)17-12-15(2)6-9-19(17)22/h4-9,12,18,21H,10-11,13H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | QXRFTZSLKJIIFB-AZUAARDMSA-N |
| XLogP | 4.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |