C13H19NO — CID 153287572
(3S,4S)-4-ethyl-3,6-dimethyl-2,4-dihydrochromen-3-amine (PubChem CID 153287572) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (3S,4S)-4-ethyl-3,6-dimethyl-2,4-dihydrochromen-3-amine.
| Compound Name | (3S,4S)-4-ethyl-3,6-dimethyl-2,4-dihydrochromen-3-amine |
|---|---|
| PubChem CID | 153287572 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (3S,4S)-4-ethyl-3,6-dimethyl-2,4-dihydrochromen-3-amine |
| SMILES | CC[C@H]1c2cc(C)ccc2OC[C@@]1(C)N |
| InChI | InChI=1S/C13H19NO/c1-4-11-10-7-9(2)5-6-12(10)15-8-13(11,3)14/h5-7,11H,4,8,14H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | DUGAXFUVLZBESY-WCQYABFASA-N |
| XLogP | 2.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |