C10H19NO4S — CID 153288741
ethyl 3-[(2S,3R)-3-hydroxy-2-(methylamino)butanoyl]sulfanylpropanoate (PubChem CID 153288741) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is ethyl 3-[(2S,3R)-3-hydroxy-2-(methylamino)butanoyl]sulfanylpropanoate.
| Compound Name | ethyl 3-[(2S,3R)-3-hydroxy-2-(methylamino)butanoyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 153288741 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | ethyl 3-[(2S,3R)-3-hydroxy-2-(methylamino)butanoyl]sulfanylpropanoate |
| SMILES | CCOC(=O)CCSC(=O)[C@@H](NC)[C@@H](C)O |
| InChI | InChI=1S/C10H19NO4S/c1-4-15-8(13)5-6-16-10(14)9(11-3)7(2)12/h7,9,11-12H,4-6H2,1-3H3/t7-,9+/m1/s1 |
| InChIKey | NHIHAEJIBNJSSC-APPZFPTMSA-N |
| XLogP | 0.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|