C35H48FN7O4SSi — CID 153289173
2-[(2S)-2,4-dimethylpiperazin-1-yl]-N-[3-[2-(2-fluoro-3-methylsulfonylanilino)-5-methylpyrimidin-4-yl]-1-(2-trimethylsilylethoxymethyl)indol-7-yl]propanamide (PubChem CID 153289173) has the molecular formula C35H48FN7O4SSi and a molecular weight of 709.97 g/mol. Its IUPAC name is 2-[(2S)-2,4-dimethylpiperazin-1-yl]-N-[3-[2-(2-fluoro-3-methylsulfonylanilino)-5-methylpyrimidin-4-yl]-1-(2-trimethylsilylethoxymethyl)indol-7-yl]propanamide.
| Compound Name | 2-[(2S)-2,4-dimethylpiperazin-1-yl]-N-[3-[2-(2-fluoro-3-methylsulfonylanilino)-5-methylpyrimidin-4-yl]-1-(2-trimethylsilylethoxymethyl)indol-7-yl]propanamide |
|---|---|
| PubChem CID | 153289173 |
| Molecular Formula | C35H48FN7O4SSi |
| Molecular Weight | 709.97 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | 2-[(2S)-2,4-dimethylpiperazin-1-yl]-N-[3-[2-(2-fluoro-3-methylsulfonylanilino)-5-methylpyrimidin-4-yl]-1-(2-trimethylsilylethoxymethyl)indol-7-yl]propanamide |
| SMILES | Cc1cnc(Nc2cccc(S(C)(=O)=O)c2F)nc1-c1cn(COCC[Si](C)(C)C)c2c(NC(=O)C(C)N3CCN(C)C[C@@H]3C)cccc12 |
| InChI | InChI=1S/C35H48FN7O4SSi/c1-23-19-37-35(39-28-12-10-14-30(31(28)36)48(5,45)46)40-32(23)27-21-42(22-47-17-18-49(6,7)8)33-26(27)11-9-13-29(33)38-34(44)25(3)43-16-15-41(4)20-24(43)2/h9-14,19,21,24-25H,15-18,20,22H2,1-8H3,(H,38,44)(H,37,39,40)/t24-,25?/m0/s1 |
| InChIKey | JORHKNIJZBHEHV-SKCDSABHSA-N |
| XLogP | 5.97 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.97 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|