C13H9ClN2O4 — CID 153289408
9-(3-chlorophenyl)-10-methyl-2,5-dioxa-1,8-diazabicyclo[5.2.1]deca-7(10),8-diene-3,4-dione (PubChem CID 153289408) has the molecular formula C13H9ClN2O4 and a molecular weight of 292.68 g/mol. Its IUPAC name is 9-(3-chlorophenyl)-10-methyl-2,5-dioxa-1,8-diazabicyclo[5.2.1]deca-7(10),8-diene-3,4-dione.
| Compound Name | 9-(3-chlorophenyl)-10-methyl-2,5-dioxa-1,8-diazabicyclo[5.2.1]deca-7(10),8-diene-3,4-dione |
|---|---|
| PubChem CID | 153289408 |
| Molecular Formula | C13H9ClN2O4 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 9-(3-chlorophenyl)-10-methyl-2,5-dioxa-1,8-diazabicyclo[5.2.1]deca-7(10),8-diene-3,4-dione |
| SMILES | Cc1c2nc(-c3cccc(Cl)c3)n1OC(=O)C(=O)OC2 |
| InChI | InChI=1S/C13H9ClN2O4/c1-7-10-6-19-12(17)13(18)20-16(7)11(15-10)8-3-2-4-9(14)5-8/h2-5H,6H2,1H3 |
| InChIKey | KGAPOXYSBUDMEV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|