C14H29NO2 — CID 153289782
3,4-ditert-butyl-5-(methoxymethyl)morpholine (PubChem CID 153289782) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 3,4-ditert-butyl-5-(methoxymethyl)morpholine.
| Compound Name | 3,4-ditert-butyl-5-(methoxymethyl)morpholine |
|---|---|
| PubChem CID | 153289782 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 3,4-ditert-butyl-5-(methoxymethyl)morpholine |
| SMILES | COCC1COCC(C(C)(C)C)N1C(C)(C)C |
| InChI | InChI=1S/C14H29NO2/c1-13(2,3)12-10-17-9-11(8-16-7)15(12)14(4,5)6/h11-12H,8-10H2,1-7H3 |
| InChIKey | DRYLKPLUABHOTJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |