C32H33N2O4+ — CID 153290031
2-[10,10-dimethyl-3-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-ium-1-ylidene)-6-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)anthracen-9-yl]terephthalic acid (PubChem CID 153290031) has the molecular formula C32H33N2O4+ and a molecular weight of 525.72 g/mol. Its IUPAC name is 2-[10,10-dimethyl-3-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-ium-1-ylidene)-6-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)anthracen-9-yl]terephthalic acid.
| Compound Name | 2-[10,10-dimethyl-3-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-ium-1-ylidene)-6-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)anthracen-9-yl]terephthalic acid |
|---|---|
| PubChem CID | 153290031 |
| Molecular Formula | C32H33N2O4+ |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | 2-[10,10-dimethyl-3-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-ium-1-ylidene)-6-(2,2,3,3,4,4,5,5-octadeuteriopyrrolidin-1-yl)anthracen-9-yl]terephthalic acid |
| SMILES | [2H]C1([2H])N(c2ccc3c(c2)C(C)(C)C2=CC(=[N+]4C([2H])([2H])C([2H])([2H])C([2H])([2H])C4([2H])[2H])C=CC2=C3c2cc(C(=O)O)ccc2C(=O)O)C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C32H32N2O4/c1-32(2)27-18-21(33-13-3-4-14-33)8-11-24(27)29(26-17-20(30(35)36)7-10-23(26)31(37)38)25-12-9-22(19-28(25)32)34-15-5-6-16-34/h7-12,17-19H,3-6,13-16H2,1-2H3,(H-,35,36,37,38)/p+1/i3D2,4D2,5D2,6D2,13D2,14D2,15D2,16D2 |
| InChIKey | XIONIUMVEOUOMC-YPJUUGFLSA-O |
| XLogP | 5.52 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|