C21H36F8O16 — CID 153290153
[1-[2,2-bis[2,3-bis(fluoromethoxy)propoxymethyl]-3-[2,3-bis(fluoroperoxy)propoxy]propoxy]-3-fluoroperoxypropan-2-yl]oxy hypofluorite (PubChem CID 153290153) has the molecular formula C21H36F8O16 and a molecular weight of 696.49 g/mol. Its IUPAC name is [1-[2,2-bis[2,3-bis(fluoromethoxy)propoxymethyl]-3-[2,3-bis(fluoroperoxy)propoxy]propoxy]-3-fluoroperoxypropan-2-yl]oxy hypofluorite.
| Compound Name | [1-[2,2-bis[2,3-bis(fluoromethoxy)propoxymethyl]-3-[2,3-bis(fluoroperoxy)propoxy]propoxy]-3-fluoroperoxypropan-2-yl]oxy hypofluorite |
|---|---|
| PubChem CID | 153290153 |
| Molecular Formula | C21H36F8O16 |
| Molecular Weight | 696.49 g/mol |
| Exact Mass | 696.19 |
| IUPAC Name | [1-[2,2-bis[2,3-bis(fluoromethoxy)propoxymethyl]-3-[2,3-bis(fluoroperoxy)propoxy]propoxy]-3-fluoroperoxypropan-2-yl]oxy hypofluorite |
| SMILES | FCOCC(COCC(COCC(COCF)OCF)(COCC(COOF)OOF)COCC(COOF)OOF)OCF |
| InChI | InChI=1S/C21H36F8O16/c22-13-34-3-17(36-15-24)1-30-9-21(10-31-2-18(37-16-25)4-35-14-23,11-32-5-19(40-44-28)7-38-42-26)12-33-6-20(41-45-29)8-39-43-27/h17-20H,1-16H2 |
| InChIKey | QIYBJUMGZVHZOR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|