C30H26N2O4S — CID 153290343
2-[3-(1,3-benzothiazol-2-yl)-7-ethyl-10,10-dimethyl-2-oxo-8,9-dihydropyrano[2,3-f]quinolin-4-yl]benzoic acid (PubChem CID 153290343) has the molecular formula C30H26N2O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)-7-ethyl-10,10-dimethyl-2-oxo-8,9-dihydropyrano[2,3-f]quinolin-4-yl]benzoic acid.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)-7-ethyl-10,10-dimethyl-2-oxo-8,9-dihydropyrano[2,3-f]quinolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 153290343 |
| Molecular Formula | C30H26N2O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)-7-ethyl-10,10-dimethyl-2-oxo-8,9-dihydropyrano[2,3-f]quinolin-4-yl]benzoic acid |
| SMILES | CCN1CCC(C)(C)c2c1ccc1c(-c3ccccc3C(=O)O)c(-c3nc4ccccc4s3)c(=O)oc21 |
| InChI | InChI=1S/C30H26N2O4S/c1-4-32-16-15-30(2,3)25-21(32)14-13-19-23(17-9-5-6-10-18(17)28(33)34)24(29(35)36-26(19)25)27-31-20-11-7-8-12-22(20)37-27/h5-14H,4,15-16H2,1-3H3,(H,33,34) |
| InChIKey | MKBHGCWOILIHMO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|