C19H38O4S — CID 153290391
dodecyl 3-(2,3-dihydroxypropylsulfanyl)-2-methylpropanoate (PubChem CID 153290391) has the molecular formula C19H38O4S and a molecular weight of 362.58 g/mol. Its IUPAC name is dodecyl 3-(2,3-dihydroxypropylsulfanyl)-2-methylpropanoate.
| Compound Name | dodecyl 3-(2,3-dihydroxypropylsulfanyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 153290391 |
| Molecular Formula | C19H38O4S |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | dodecyl 3-(2,3-dihydroxypropylsulfanyl)-2-methylpropanoate |
| SMILES | CCCCCCCCCCCCOC(=O)C(C)CSCC(O)CO |
| InChI | InChI=1S/C19H38O4S/c1-3-4-5-6-7-8-9-10-11-12-13-23-19(22)17(2)15-24-16-18(21)14-20/h17-18,20-21H,3-16H2,1-2H3 |
| InChIKey | FNRUYZWYRRNRMI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|