About 2,6-diiodo-3,7-dimethylnaphthalene
2,6-diiodo-3,7-dimethylnaphthalene (PubChem CID 153291059) has the molecular formula C12H10I2
and a molecular weight of 408.02 g/mol. Its IUPAC name is 2,6-diiodo-3,7-dimethylnaphthalene.
Molecular Properties
| Compound Name | 2,6-diiodo-3,7-dimethylnaphthalene |
| PubChem CID | 153291059 |
| Molecular Formula | C12H10I2 |
| Molecular Weight | 408.02 g/mol |
| Exact Mass | 407.89 |
| IUPAC Name | 2,6-diiodo-3,7-dimethylnaphthalene |
| SMILES | Cc1cc2cc(I)c(C)cc2cc1I |
| InChI | InChI=1S/C12H10I2/c1-7-3-9-6-12(14)8(2)4-10(9)5-11(7)13/h3-6H,1-2H3 |
| InChIKey | VXCHVNXZNDWHMN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.02 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diiodo-3,7-dimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diiodo-3,7-dimethylnaphthalene?
The IUPAC name of 2,6-diiodo-3,7-dimethylnaphthalene (CID 153291059) is 2,6-diiodo-3,7-dimethylnaphthalene.
What is the SMILES notation for 2,6-diiodo-3,7-dimethylnaphthalene?
The canonical SMILES for 2,6-diiodo-3,7-dimethylnaphthalene is Cc1cc2cc(I)c(C)cc2cc1I.
What is the InChIKey of 2,6-diiodo-3,7-dimethylnaphthalene?
The InChIKey is VXCHVNXZNDWHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10I2/c1-7-3-9-6-12(14)8(2)4-10(9)5-11(7)13/h3-6H,1-2H3.
What are the key properties of 2,6-diiodo-3,7-dimethylnaphthalene?
2,6-diiodo-3,7-dimethylnaphthalene has a molecular weight of 408.02 g/mol, XLogP of 4.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diiodo-3,7-dimethylnaphthalene is sourced from PubChem (CID 153291059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).