C16H34N2 — CID 153291240
(5S)-5-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine (PubChem CID 153291240) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is (5S)-5-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine.
| Compound Name | (5S)-5-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine |
|---|---|
| PubChem CID | 153291240 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | (5S)-5-tert-butyl-N,1-di(propan-2-yl)azepan-4-amine |
| SMILES | CC(C)NC1CCN(C(C)C)CC[C@H]1C(C)(C)C |
| InChI | InChI=1S/C16H34N2/c1-12(2)17-15-9-11-18(13(3)4)10-8-14(15)16(5,6)7/h12-15,17H,8-11H2,1-7H3/t14-,15?/m1/s1 |
| InChIKey | XBCWCIMBOBFBEB-GICMACPYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |