C13H28N2 — CID 153291285
(2R)-2-ethyl-1,4-di(propan-2-yl)-1,4-diazepane (PubChem CID 153291285) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is (2R)-2-ethyl-1,4-di(propan-2-yl)-1,4-diazepane.
| Compound Name | (2R)-2-ethyl-1,4-di(propan-2-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 153291285 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | (2R)-2-ethyl-1,4-di(propan-2-yl)-1,4-diazepane |
| SMILES | CC[C@@H]1CN(C(C)C)CCCN1C(C)C |
| InChI | InChI=1S/C13H28N2/c1-6-13-10-14(11(2)3)8-7-9-15(13)12(4)5/h11-13H,6-10H2,1-5H3/t13-/m1/s1 |
| InChIKey | GATBBKXCQMYQAJ-CYBMUJFWSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |