C42H30N3OPS — CID 153292089
6-(4,6-diphenyl-1,3,5-triazin-2-yl)-14,14-dimethyl-21-phenyl-10-thia-21λ5-phosphapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene 21-oxide (PubChem CID 153292089) has the molecular formula C42H30N3OPS and a molecular weight of 655.76 g/mol. Its IUPAC name is 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-14,14-dimethyl-21-phenyl-10-thia-21λ5-phosphapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene 21-oxide.
| Compound Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-14,14-dimethyl-21-phenyl-10-thia-21λ5-phosphapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene 21-oxide |
|---|---|
| PubChem CID | 153292089 |
| Molecular Formula | C42H30N3OPS |
| Molecular Weight | 655.76 g/mol |
| Exact Mass | 655.18 |
| IUPAC Name | 6-(4,6-diphenyl-1,3,5-triazin-2-yl)-14,14-dimethyl-21-phenyl-10-thia-21λ5-phosphapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene 21-oxide |
| SMILES | CC1(C)c2ccccc2P(=O)(c2ccccc2)c2cc3c(cc21)sc1ccc(-c2nc(-c4ccccc4)nc(-c4ccccc4)n2)cc13 |
| InChI | InChI=1S/C42H30N3OPS/c1-42(2)33-20-12-13-21-35(33)47(46,30-18-10-5-11-19-30)36-25-32-31-24-29(22-23-37(31)48-38(32)26-34(36)42)41-44-39(27-14-6-3-7-15-27)43-40(45-41)28-16-8-4-9-17-28/h3-26H,1-2H3 |
| InChIKey | GQNPWPUPLVZYNU-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.76 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|