C20H18ClFN4O2 — CID 153292244
7-chloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-6-fluoro-4-hydroxy-3-isocyano-1,8-naphthyridin-2-one (PubChem CID 153292244) has the molecular formula C20H18ClFN4O2 and a molecular weight of 400.84 g/mol. Its IUPAC name is 7-chloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-6-fluoro-4-hydroxy-3-isocyano-1,8-naphthyridin-2-one.
| Compound Name | 7-chloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-6-fluoro-4-hydroxy-3-isocyano-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 153292244 |
| Molecular Formula | C20H18ClFN4O2 |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 7-chloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-6-fluoro-4-hydroxy-3-isocyano-1,8-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1c(O)c2cc(F)c(Cl)nc2n(-c2c(C(C)C)ccnc2C(C)C)c1=O |
| InChI | InChI=1S/C20H18ClFN4O2/c1-9(2)11-6-7-24-14(10(3)4)16(11)26-19-12(8-13(22)18(21)25-19)17(27)15(23-5)20(26)28/h6-10,27H,1-4H3 |
| InChIKey | WPKSEDRBGHSVAV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|