C25H21ClFN5O2 — CID 153292295
6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-7-(2-fluorophenyl)-4-hydroxy-3-isocyano-1,8-naphthyridin-2-one (PubChem CID 153292295) has the molecular formula C25H21ClFN5O2 and a molecular weight of 477.93 g/mol. Its IUPAC name is 6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-7-(2-fluorophenyl)-4-hydroxy-3-isocyano-1,8-naphthyridin-2-one.
| Compound Name | 6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-7-(2-fluorophenyl)-4-hydroxy-3-isocyano-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 153292295 |
| Molecular Formula | C25H21ClFN5O2 |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-7-(2-fluorophenyl)-4-hydroxy-3-isocyano-1,8-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1c(O)c2cc(Cl)c(-c3ccccc3F)nc2n(-c2c(C(C)C)ncnc2C(C)C)c1=O |
| InChI | InChI=1S/C25H21ClFN5O2/c1-12(2)18-22(19(13(3)4)30-11-29-18)32-24-15(23(33)21(28-5)25(32)34)10-16(26)20(31-24)14-8-6-7-9-17(14)27/h6-13,33H,1-4H3 |
| InChIKey | ZBNRUGMZWUPDIT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 85.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|