C17H15FN8O3 — CID 153293781
N-[9-[4-azido-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 153293781) has the molecular formula C17H15FN8O3 and a molecular weight of 398.36 g/mol. Its IUPAC name is N-[9-[4-azido-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[4-azido-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 153293781 |
| Molecular Formula | C17H15FN8O3 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[9-[4-azido-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | [N-]=[N+]=NC1C(CO)OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)C1F |
| InChI | InChI=1S/C17H15FN8O3/c18-11-12(24-25-19)10(6-27)29-17(11)26-8-22-13-14(20-7-21-15(13)26)23-16(28)9-4-2-1-3-5-9/h1-5,7-8,10-12,17,27H,6H2,(H,20,21,23,28) |
| InChIKey | VJMVXZJKXSIXAG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 150.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|