C45H33Br2N — CID 153294011
N,N-bis(4-bromophenyl)-3-(9,9-dimethylfluoren-2-yl)-4-(4-phenylphenyl)aniline (PubChem CID 153294011) has the molecular formula C45H33Br2N and a molecular weight of 747.57 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-3-(9,9-dimethylfluoren-2-yl)-4-(4-phenylphenyl)aniline.
| Compound Name | N,N-bis(4-bromophenyl)-3-(9,9-dimethylfluoren-2-yl)-4-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 153294011 |
| Molecular Formula | C45H33Br2N |
| Molecular Weight | 747.57 g/mol |
| Exact Mass | 745.10 |
| IUPAC Name | N,N-bis(4-bromophenyl)-3-(9,9-dimethylfluoren-2-yl)-4-(4-phenylphenyl)aniline |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc(N(c4ccc(Br)cc4)c4ccc(Br)cc4)ccc3-c3ccc(-c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C45H33Br2N/c1-45(2)43-11-7-6-10-40(43)41-26-16-33(28-44(41)45)42-29-38(48(36-21-17-34(46)18-22-36)37-23-19-35(47)20-24-37)25-27-39(42)32-14-12-31(13-15-32)30-8-4-3-5-9-30/h3-29H,1-2H3 |
| InChIKey | FEWBQNWDKDWSRS-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.57 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |